CAS 17190-77-1 appears in our catalog under these names: 2,2-Dimethyl-1h-indene-1,3(2h)-dione, 95%, 2,2–Dimethyl–1H–indene–1,3(2H)–dione, 2,2-Dimethyl-1H-indene-1,3(2H)-dione, >95%, >95%, 2,2-Dimethyl-1H-indene-1,3(2H)-dione, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2,2-dimethylindene-1,3-dione (CAS 17190-77-1) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 2,2-dimethylindene-1,3-dione. InChIKey: BNPBWSGZTORGIH-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2,2-dimethylindene-1,3-dione |
| InChIKey | BNPBWSGZTORGIH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C2=CC=CC=C2C1=O)C |
Computed by PubChem (NCBI)