CAS 171975-85-2 appears in our catalog under these names: 2-(Benzyloxy)-3-bromo-7-naphthol, 95%, 7-(Benzyloxy)-6-bromonaphthalen-2-ol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-bromo-7-phenylmethoxynaphthalen-2-ol (CAS 171975-85-2) is a chemical compound with the molecular formula C17H13BrO2 and a molecular weight of 329.2 g/mol. IUPAC name: 6-bromo-7-phenylmethoxynaphthalen-2-ol. InChIKey: YHRCPQNCRQLBGB-UHFFFAOYSA-N.
| Molecular formula | C17H13BrO2 |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | 6-bromo-7-phenylmethoxynaphthalen-2-ol |
| InChIKey | YHRCPQNCRQLBGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C3C=CC(=CC3=C2)O)Br |
Computed by PubChem (NCBI)