CAS 172213-74-0 appears in our catalog under these names: 5R-Hydroxy-L-lysine Dihydrochloride Salt, >95% (HPLC), L-Hydroxylysine dihydrochloride, L-hydroxylysine (dihydrochloride). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 10 mg, 1 mg.
[(1S,4R)-5-azaniumyl-1-carboxy-4-hydroxypentyl]azanium dichloride (CAS 172213-74-0) is a chemical compound with the molecular formula C6H16Cl2N2O3 and a molecular weight of 235.11 g/mol. IUPAC name: [(1S,4R)-5-azaniumyl-1-carboxy-4-hydroxypentyl]azanium dichloride. InChIKey: WUHHWACUVRCFHE-CIFXRNLBSA-N.
| Molecular formula | C6H16Cl2N2O3 |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | [(1S,4R)-5-azaniumyl-1-carboxy-4-hydroxypentyl]azanium dichloride |
| InChIKey | WUHHWACUVRCFHE-CIFXRNLBSA-N |
| SMILES | C(C[C@@H](C(=O)O)[NH3+])[C@H](C[NH3+])O.[Cl-].[Cl-] |
Computed by PubChem (NCBI)