Products 172221-28-2

CAS 172221-28-2 is the registry number for Methyl 4-amino-3-iodo-5-nitrobenzoate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-3-iodo-5-nitrobenzoate (CAS 172221-28-2) is a chemical compound with the molecular formula C8H7IN2O4 and a molecular weight of 322.06 g/mol. IUPAC name: methyl 4-amino-3-iodo-5-nitrobenzoate. InChIKey: XLFPLFMZXZTMPC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7IN2O4
Molecular weight322.06 g/mol
IUPAC namemethyl 4-amino-3-iodo-5-nitrobenzoate
InChIKeyXLFPLFMZXZTMPC-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C(=C1)I)N)[N+](=O)[O-]

Computed by PubChem (NCBI)