CAS 172265-90-6 appears in our catalog under these names: Potassium 2-isopropyl-5-methylphenyl sulfate, 98%, Thymol sulfate potassium, Thymol sulfate potassium salt, Thymol sulfate potassium salt, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, Biosynth, HPC Standards. Available pack sizes: on request, 1g, 1x5mg, 1x1ml.
Potassium (5-methyl-2-propan-2-ylphenyl) sulfate (CAS 172265-90-6) is a chemical compound with the molecular formula C10H13KO4S and a molecular weight of 268.37 g/mol. IUPAC name: potassium (5-methyl-2-propan-2-ylphenyl) sulfate. InChIKey: LSWDPFMSOKRHJG-UHFFFAOYSA-M.
| Molecular formula | C10H13KO4S |
|---|---|
| Molecular weight | 268.37 g/mol |
| IUPAC name | potassium (5-methyl-2-propan-2-ylphenyl) sulfate |
| InChIKey | LSWDPFMSOKRHJG-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C=C1)C(C)C)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)