Products 172282-33-6

CAS 172282-33-6 is the registry number for tert-Butyl 2-(tributylstannyl)-1H-pyrrole-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-tributylstannylpyrrole-1-carboxylate (CAS 172282-33-6) is a chemical compound with the molecular formula C21H39NO2Sn and a molecular weight of 456.2 g/mol. IUPAC name: tert-butyl 2-tributylstannylpyrrole-1-carboxylate. InChIKey: VGFTUFMCGLLLIB-UHFFFAOYSA-N.

Identity
Molecular formulaC21H39NO2Sn
Molecular weight456.2 g/mol
IUPAC nametert-butyl 2-tributylstannylpyrrole-1-carboxylate
InChIKeyVGFTUFMCGLLLIB-UHFFFAOYSA-N
SMILESCCCC[Sn](CCCC)(CCCC)C1=CC=CN1C(=O)OC(C)(C)C

Computed by PubChem (NCBI)