CAS 17235-98-2 appears in our catalog under these names: Diethyl 2-(1,1-dioxido-2,3-dihydrothiophen-3-yl)malonate, 95%, 1,3-Diethyl 2-(1,1-dioxo-2,3-dihydro-1λâ¶-thiophen-3-yl)propanedioate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
Diethyl 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)propanedioate (CAS 17235-98-2) is a chemical compound with the molecular formula C11H16O6S and a molecular weight of 276.31 g/mol. IUPAC name: diethyl 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)propanedioate. InChIKey: OBJCFNOZRVGMTK-UHFFFAOYSA-N.
| Molecular formula | C11H16O6S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | diethyl 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)propanedioate |
| InChIKey | OBJCFNOZRVGMTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1CS(=O)(=O)C=C1)C(=O)OCC |
Computed by PubChem (NCBI)