CAS 172513-77-8 appears in our catalog under these names: Sodium 1h-indol-2-ylacetate, 95%, Sodium 2-(1H-indol-2-yl)acetate, 97%, Sodium 2–(1H–indol–2–yl)acetate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 25mg.
Sodium 2-(1H-indol-2-yl)acetate (CAS 172513-77-8) is a chemical compound with the molecular formula C10H8NNaO2 and a molecular weight of 197.17 g/mol. IUPAC name: sodium 2-(1H-indol-2-yl)acetate. InChIKey: BEPSIKQQPOTABL-UHFFFAOYSA-M.
| Molecular formula | C10H8NNaO2 |
|---|---|
| Molecular weight | 197.17 g/mol |
| IUPAC name | sodium 2-(1H-indol-2-yl)acetate |
| InChIKey | BEPSIKQQPOTABL-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=C(N2)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)