CAS 172516-42-6 is the registry number for methyl 3-(ethylthio)-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Methyl 3-ethylsulfanyl-6,6-dimethyl-4-oxo-5,7-dihydro-2-benzothiophene-1-carboxylate (CAS 172516-42-6) is a chemical compound with the molecular formula C14H18O3S2 and a molecular weight of 298.4 g/mol. IUPAC name: methyl 3-ethylsulfanyl-6,6-dimethyl-4-oxo-5,7-dihydro-2-benzothiophene-1-carboxylate. InChIKey: DGCDOLUIZCGQES-UHFFFAOYSA-N.
| Molecular formula | C14H18O3S2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | methyl 3-ethylsulfanyl-6,6-dimethyl-4-oxo-5,7-dihydro-2-benzothiophene-1-carboxylate |
| InChIKey | DGCDOLUIZCGQES-UHFFFAOYSA-N |
| SMILES | CCSC1=C2C(=C(S1)C(=O)OC)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)