CAS 17252-77-6 appears in our catalog under these names: N-Octane-d18, >95% (GC), n-Octane-d18 (Reagent grade), 99 atom % D, min 99% Chemical Purity, Octane–d??, n-Octane-d{18}, 99% (Isotopic) , n-Octane-D18 99 atom % D. Offered by: TRC, CDN, GLPBio, Thermo Scientific (Alfa Aesar), Deutero. Available pack sizes: 2,5mg, 25mg, 5mg, 5g, 1g, 0,7ml, 5ml, 1x5ml.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecadeuteriooctane (CAS 17252-77-6) is a chemical compound with the molecular formula C8H18 and a molecular weight of 132.34 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecadeuteriooctane. InChIKey: TVMXDCGIABBOFY-VAZJTQEUSA-N.
| Molecular formula | C8H18 |
|---|---|
| Molecular weight | 132.34 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecadeuteriooctane |
| InChIKey | TVMXDCGIABBOFY-VAZJTQEUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)