CAS 1726-94-9 appears in our catalog under these names: Trityl isothiocyanate, 95%, Trityl isothiocyanate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 2g, 10g, 1g.
[isothiocyanato(diphenyl)methyl]benzene (CAS 1726-94-9) is a chemical compound with the molecular formula C20H15NS and a molecular weight of 301.4 g/mol. IUPAC name: [isothiocyanato(diphenyl)methyl]benzene. InChIKey: ZPZHAUXTGFNYTN-UHFFFAOYSA-N.
| Molecular formula | C20H15NS |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | [isothiocyanato(diphenyl)methyl]benzene |
| InChIKey | ZPZHAUXTGFNYTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N=C=S |
Computed by PubChem (NCBI)