CAS 172606-25-6 is the registry number for 1,3,5-Tris((1H-pyrazol-1-yl)methyl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[3,5-bis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole (CAS 172606-25-6) is a chemical compound with the molecular formula C18H18N6 and a molecular weight of 318.4 g/mol. IUPAC name: 1-[[3,5-bis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole. InChIKey: IRBWFDAPHKEMOR-UHFFFAOYSA-N.
| Molecular formula | C18H18N6 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 1-[[3,5-bis(pyrazol-1-ylmethyl)phenyl]methyl]pyrazole |
| InChIKey | IRBWFDAPHKEMOR-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CC2=CC(=CC(=C2)CN3C=CC=N3)CN4C=CC=N4 |
Computed by PubChem (NCBI)