CAS 172617-46-8 is the registry number for Pt(II) Octaethylporphine ketone. Offered by: GLPBio. Available pack sizes: 10mg.
Platinum(II) octaethylporphyrin ketone is a platinum(II) porphyrin compound having a 2-keto group and eight ethyl substituents in the 3-, 3-, 7-, 8-, 12-, 13-, 17- and 18-positions. It has a role as a fluorochrome.
Source: ChEBI
| Molecular formula | C36H44N4OPt |
|---|---|
| Molecular weight | 743.8 g/mol |
| IUPAC name | 3,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diid-2-one;platinum(2+) |
| InChIKey | DKPOGYJJFLIBKP-UHFFFAOYSA-M |
| SMILES | CCC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)CC)CC)CC)CC)C(C3=O)(CC)CC)CC.[Pt+2] |
Computed by PubChem (NCBI)