CAS 17265-14-4 appears in our catalog under these names: Decanedioic acid disodium salt, 98%, Disodium Sebacate, Disodium Sebacate, >97.0%(T), Disodium Sebacate 98%, SEBACICACIDDISODIUMSALT, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 500g, 1kg, 5g, 25g, 1000g, 100 g, 25 g.
Disodium;decanedioate (CAS 17265-14-4) is a chemical compound with the molecular formula C10H16Na2O4 and a molecular weight of 246.21 g/mol. IUPAC name: disodium;decanedioate. InChIKey: NCXUIEDQTCQZRK-UHFFFAOYSA-L.
| Molecular formula | C10H16Na2O4 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | disodium;decanedioate |
| InChIKey | NCXUIEDQTCQZRK-UHFFFAOYSA-L |
| SMILES | C(CCCCC(=O)[O-])CCCC(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)