CAS 17271-89-5 appears in our catalog under these names: 1–(Azidomethyl)–4–methylbenzene solution, 1-(azidomethyl)-4-methylbenzene, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 10ml, 250mg.
1-(azidomethyl)-4-methylbenzene (CAS 17271-89-5) is a chemical compound with the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. IUPAC name: 1-(azidomethyl)-4-methylbenzene. InChIKey: NBXGSUCKCKGTCH-UHFFFAOYSA-N.
| Molecular formula | C8H9N3 |
|---|---|
| Molecular weight | 147.18 g/mol |
| IUPAC name | 1-(azidomethyl)-4-methylbenzene |
| InChIKey | NBXGSUCKCKGTCH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)