CAS 172733-42-5 appears in our catalog under these names: Varespladib sodium, Varespladib sodium, Varespladib (sodium), Varespladib (sodium), 98.83%, Varespladib (sodium) (Standard). Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 50mg, 100mg, 5mg, 10mg, 25mg, 10mM/1mL, 50 mg.
Sodium 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetate (CAS 172733-42-5) is a chemical compound with the molecular formula C21H19N2NaO5 and a molecular weight of 402.4 g/mol. IUPAC name: sodium 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetate. InChIKey: XZZUHXILQXLTGV-UHFFFAOYSA-M.
| Molecular formula | C21H19N2NaO5 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | sodium 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetate |
| InChIKey | XZZUHXILQXLTGV-UHFFFAOYSA-M |
| SMILES | CCC1=C(C2=C(N1CC3=CC=CC=C3)C=CC=C2OCC(=O)[O-])C(=O)C(=O)N.[Na+] |
Computed by PubChem (NCBI)