CAS 1728-97-8 is the registry number for 4-(4,5-diphenyl-1H-imidazol-2-yl)-N,N-dimethylaniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-(4,5-diphenyl-1H-imidazol-2-yl)-N,N-dimethylaniline (CAS 1728-97-8) is a chemical compound with the molecular formula C23H21N3 and a molecular weight of 339.4 g/mol. IUPAC name: 4-(4,5-diphenyl-1H-imidazol-2-yl)-N,N-dimethylaniline. InChIKey: LTGRDWFVGBZDIR-UHFFFAOYSA-N.
| Molecular formula | C23H21N3 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 4-(4,5-diphenyl-1H-imidazol-2-yl)-N,N-dimethylaniline |
| InChIKey | LTGRDWFVGBZDIR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)