CAS 17280-49-8 appears in our catalog under these names: N-(4-Iodophenyl)maleamic acid, 95%, 4-((4-Iodophenyl)amino)-4-oxobut-2-enoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
(E)-4-(4-iodoanilino)-4-oxobut-2-enoic acid (CAS 17280-49-8) is a chemical compound with the molecular formula C10H8INO3 and a molecular weight of 317.08 g/mol. IUPAC name: (E)-4-(4-iodoanilino)-4-oxobut-2-enoic acid. InChIKey: KSVGHDGDESFZOK-AATRIKPKSA-N.
| Molecular formula | C10H8INO3 |
|---|---|
| Molecular weight | 317.08 g/mol |
| IUPAC name | (E)-4-(4-iodoanilino)-4-oxobut-2-enoic acid |
| InChIKey | KSVGHDGDESFZOK-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)/C=C/C(=O)O)I |
Computed by PubChem (NCBI)