CAS 17283-01-1 is the registry number for 2-(2,4-Diphenylquinolin-3-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2,4-diphenylquinolin-3-yl)acetic acid (CAS 17283-01-1) is a chemical compound with the molecular formula C23H17NO2 and a molecular weight of 339.4 g/mol. IUPAC name: 2-(2,4-diphenylquinolin-3-yl)acetic acid. InChIKey: MHFRKLRDQBXFKB-UHFFFAOYSA-N.
| Molecular formula | C23H17NO2 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-(2,4-diphenylquinolin-3-yl)acetic acid |
| InChIKey | MHFRKLRDQBXFKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NC3=CC=CC=C32)C4=CC=CC=C4)CC(=O)O |
Computed by PubChem (NCBI)