CAS 172854-55-6 appears in our catalog under these names: GR 55562 hydrochloride, GR 55562 (hydrochloride), 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg.
3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;hydrochloride (CAS 172854-55-6) is a chemical compound with the molecular formula C23H26ClN3O2 and a molecular weight of 411.9 g/mol. IUPAC name: 3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;hydrochloride. InChIKey: NUDSRNNZTVHCKY-UHFFFAOYSA-N.
| Molecular formula | C23H26ClN3O2 |
|---|---|
| Molecular weight | 411.9 g/mol |
| IUPAC name | 3-[3-(dimethylamino)propyl]-4-hydroxy-N-(4-pyridin-4-ylphenyl)benzamide;hydrochloride |
| InChIKey | NUDSRNNZTVHCKY-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1=C(C=CC(=C1)C(=O)NC2=CC=C(C=C2)C3=CC=NC=C3)O.Cl |
Computed by PubChem (NCBI)