CAS 172895-15-7 appears in our catalog under these names: LY 272015 Hydrochloride, LY 272015 hydrochloride/ 99.47% (existing batch purity), LY 272015 hydrochloride, LY272015, 99.47% ,, 99.47% ,, LY-272015 (hydrochloride), 99.54%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 200mg.
1-[(3,4-dimethoxyphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (CAS 172895-15-7) is a chemical compound with the molecular formula C21H25ClN2O2 and a molecular weight of 372.9 g/mol. IUPAC name: 1-[(3,4-dimethoxyphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride. InChIKey: BKAZOTIBKRWLQA-UHFFFAOYSA-N.
| Molecular formula | C21H25ClN2O2 |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | 1-[(3,4-dimethoxyphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| InChIKey | BKAZOTIBKRWLQA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2CCNC3CC4=CC(=C(C=C4)OC)OC.Cl |
Computed by PubChem (NCBI)