Products 172927-65-0
CAS 172927-65-0 appears in our catalog under these names: Sibrafiban, Sibrafiban (Standard), Sibrafiban, 99.67%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), Get quote, 10 mg, 25 mg, 50 mg.
Ethyl 2-[1-[(2S)-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]propanoyl]piperidin-4-yl]oxyacetate (CAS 172927-65-0) is a chemical compound with the molecular formula C20H28N4O6 and a molecular weight of 420.5 g/mol. IUPAC name: ethyl 2-[1-[(2S)-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]propanoyl]piperidin-4-yl]oxyacetate. InChIKey: WBNUCLPUOSXSNJ-ZDUSSCGKSA-N.
| Molecular formula | C20H28N4O6 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | ethyl 2-[1-[(2S)-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]propanoyl]piperidin-4-yl]oxyacetate |
| InChIKey | WBNUCLPUOSXSNJ-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)COC1CCN(CC1)C(=O)[C@H](C)NC(=O)C2=CC=C(C=C2)/C(=N/O)/N |
Computed by PubChem (NCBI)