CAS 172932-10-4 appears in our catalog under these names: 4-(2-Chloro-6-fluorobenzyloxy)benzaldehyde, 95%, 4-((2-Chloro-6-fluorobenzyl)oxy)benzaldehyde, 97%. Offered by: Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 1g, 5g.
4-[(2-chloro-6-fluorophenyl)methoxy]benzaldehyde (CAS 172932-10-4) is a chemical compound with the molecular formula C14H10ClFO2 and a molecular weight of 264.68 g/mol. IUPAC name: 4-[(2-chloro-6-fluorophenyl)methoxy]benzaldehyde. InChIKey: WOUZCDNRKXWPDY-UHFFFAOYSA-N.
| Molecular formula | C14H10ClFO2 |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | 4-[(2-chloro-6-fluorophenyl)methoxy]benzaldehyde |
| InChIKey | WOUZCDNRKXWPDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)COC2=CC=C(C=C2)C=O)F |
Computed by PubChem (NCBI)