CAS 172986-25-3 appears in our catalog under these names: Cinazepam, Cinazepam, 99.1%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 5 mg, 1 mg.
4-[[7-bromo-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]oxy]-4-oxobutanoic acid (CAS 172986-25-3) is a chemical compound with the molecular formula C19H14BrClN2O5 and a molecular weight of 465.7 g/mol. IUPAC name: 4-[[7-bromo-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]oxy]-4-oxobutanoic acid. InChIKey: NQTRBZXDWMDXAQ-UHFFFAOYSA-N.
| Molecular formula | C19H14BrClN2O5 |
|---|---|
| Molecular weight | 465.7 g/mol |
| IUPAC name | 4-[[7-bromo-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]oxy]-4-oxobutanoic acid |
| InChIKey | NQTRBZXDWMDXAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(C(=O)NC3=C2C=C(C=C3)Br)OC(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)