CAS 173035-10-4 appears in our catalog under these names: 1,3-Bis(2,4,6-trimethylphenyl)imidazolidinium chloride, 97%, 1,3-Bis(2,4,6-trimethylphenyl)imidazolinium Chloride, >98.0%(HPLC)(T), 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride 97%, 1,3-BIS(2,4,6-TRIMETHYLPHENYL)IMIDAZOLI&, 1,3-Bis(2,4,6-trimethylphenyl)imidazolinium Chloride, 98%, 98%. Offered by: Thermo Scientific (Acros), TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 50g, 250g.
1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium chloride (CAS 173035-10-4) is a chemical compound with the molecular formula C21H27ClN2 and a molecular weight of 342.9 g/mol. IUPAC name: 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium chloride. InChIKey: COGMCBFILULEOS-UHFFFAOYSA-M.
| Molecular formula | C21H27ClN2 |
|---|---|
| Molecular weight | 342.9 g/mol |
| IUPAC name | 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium chloride |
| InChIKey | COGMCBFILULEOS-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2CC[N+](=C2)C3=C(C=C(C=C3C)C)C)C.[Cl-] |
Computed by PubChem (NCBI)