CAS 17318-03-5 appears in our catalog under these names: 3-Fluorophenylmagnesium bromide, 1M solution in THF, AcroSeal®, 3-FLUOROPHENYLMAGNESIUM BROMIDE, 1.0M. Offered by: Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100ML, 4X25ML.
Magnesium;fluorobenzene;bromide (CAS 17318-03-5) is a chemical compound with the molecular formula C6H4BrFMg and a molecular weight of 199.30 g/mol. IUPAC name: magnesium;fluorobenzene;bromide. InChIKey: DTKMKZYEOXZPQZ-UHFFFAOYSA-M.
| Molecular formula | C6H4BrFMg |
|---|---|
| Molecular weight | 199.30 g/mol |
| IUPAC name | magnesium;fluorobenzene;bromide |
| InChIKey | DTKMKZYEOXZPQZ-UHFFFAOYSA-M |
| SMILES | C1=C[C-]=CC(=C1)F.[Mg+2].[Br-] |
Computed by PubChem (NCBI)