CAS 1733-83-1 appears in our catalog under these names: Naphthol as sulphate potassium salt, 95%, Naphthol AS sulphate potassium. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
Potassium [3-(phenylcarbamoyl)naphthalen-2-yl] sulfate (CAS 1733-83-1) is a chemical compound with the molecular formula C17H12KNO5S and a molecular weight of 381.4 g/mol. IUPAC name: potassium [3-(phenylcarbamoyl)naphthalen-2-yl] sulfate. InChIKey: UIEOFHYTXGEGHV-UHFFFAOYSA-M.
| Molecular formula | C17H12KNO5S |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | potassium [3-(phenylcarbamoyl)naphthalen-2-yl] sulfate |
| InChIKey | UIEOFHYTXGEGHV-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC3=CC=CC=C3C=C2OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)