CAS 1733-88-6 appears in our catalog under these names: Potassium phenyl sulfate, 98%, Potassium Phenyl Sulfate, Potassium Phenyl Sulfate, Potassium Phenyl Sulfate, >98.0%(HPLC)(T), Potassium phenyl sulfate 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 1g, 250mg, 200mg, 2g, 100mg.
Potassium phenyl sulfate (CAS 1733-88-6) is a chemical compound with the molecular formula C6H5KO4S and a molecular weight of 212.27 g/mol. IUPAC name: potassium phenyl sulfate. InChIKey: NOUFXYHWAWIDNT-UHFFFAOYSA-M.
| Molecular formula | C6H5KO4S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | potassium phenyl sulfate |
| InChIKey | NOUFXYHWAWIDNT-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)