CAS 173349-22-9 appears in our catalog under these names: alpha-D-1,5-Difluoroglucose, a-D-1,5-Difluoroglucose. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 1mg, 10mg.
(2S,3S,4R,5R,6R)-2,6-difluoro-2-(hydroxymethyl)oxane-3,4,5-triol (CAS 173349-22-9) is a chemical compound with the molecular formula C6H10F2O5 and a molecular weight of 200.14 g/mol. IUPAC name: (2S,3S,4R,5R,6R)-2,6-difluoro-2-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: MGHYRMVVRYCAON-RWOPYEJCSA-N.
| Molecular formula | C6H10F2O5 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | (2S,3S,4R,5R,6R)-2,6-difluoro-2-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | MGHYRMVVRYCAON-RWOPYEJCSA-N |
| SMILES | C([C@@]1([C@H]([C@@H]([C@H]([C@H](O1)F)O)O)O)F)O |
Computed by PubChem (NCBI)