Products 173470-69-4

CAS 173470-69-4 is the registry number for TRICHLOROACETIC-1-13C ACID, 99 ATOM % 1&. Offered by: Sigma-Aldrich. Available pack sizes: 1G.

Structural formula: {0} (CAS {1})

2,2,2-trichloroacetic acid (CAS 173470-69-4) is a chemical compound with the molecular formula C2HCl3O2 and a molecular weight of 164.38 g/mol. IUPAC name: 2,2,2-trichloroacetic acid. InChIKey: YNJBWRMUSHSURL-OUBTZVSYSA-N.

Identity
Molecular formulaC2HCl3O2
Molecular weight164.38 g/mol
IUPAC name2,2,2-trichloroacetic acid
InChIKeyYNJBWRMUSHSURL-OUBTZVSYSA-N
SMILES[13C](=O)(C(Cl)(Cl)Cl)O

Computed by PubChem (NCBI)