CAS 173472-42-9 is the registry number for Boc-L-Met-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
Tert-butyl N-[(3S)-1-diazo-5-methylsulfanyl-2-oxopentan-3-yl]carbamate (CAS 173472-42-9) is a chemical compound with the molecular formula C11H19N3O3S and a molecular weight of 273.35 g/mol. IUPAC name: tert-butyl N-[(3S)-1-diazo-5-methylsulfanyl-2-oxopentan-3-yl]carbamate. InChIKey: XNGHBTCJCONBSA-QMMMGPOBSA-N.
| Molecular formula | C11H19N3O3S |
|---|---|
| Molecular weight | 273.35 g/mol |
| IUPAC name | tert-butyl N-[(3S)-1-diazo-5-methylsulfanyl-2-oxopentan-3-yl]carbamate |
| InChIKey | XNGHBTCJCONBSA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC)C(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)