Products 17351-32-5
CAS 17351-32-5 appears in our catalog under these names: For-met-ala-ser, 95%, N-Formyl-Met-Ala-Ser, 95%, For–Met–Ala–Ser–OH, For-Met-Ala-Ser, ≥95%, ≥95%, N-Formyl-Met-Ala-Ser, 98.08%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 50mg, 5mg, 25mg, 10 mg, 5 mg.
(2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoyl]amino]-3-hydroxypropanoic acid (CAS 17351-32-5) is a chemical compound with the molecular formula C12H21N3O6S and a molecular weight of 335.38 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoyl]amino]-3-hydroxypropanoic acid. InChIKey: FRPHJRVMOFQLPK-CIUDSAMLSA-N.
| Molecular formula | C12H21N3O6S |
|---|---|
| Molecular weight | 335.38 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoyl]amino]-3-hydroxypropanoic acid |
| InChIKey | FRPHJRVMOFQLPK-CIUDSAMLSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CO)C(=O)O)NC(=O)[C@H](CCSC)NC=O |
Computed by PubChem (NCBI)