CAS 17351-61-0 appears in our catalog under these names: Tetraethylammonium hydrogencarbonate, Tetraethylammonium hydrogencarbonate 95%, TETRAETHYLAMMONIUM BICARBONATE, >=95.0%, Tetraethylammonium hydrogencarbonate, 97%, 97%, Tetraethylammonium hydrogencarbonate, 97%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100mg, 100g.
Hydrogen carbonate;tetraethylazanium (CAS 17351-61-0) is a chemical compound with the molecular formula C9H21NO3 and a molecular weight of 191.27 g/mol. IUPAC name: hydrogen carbonate;tetraethylazanium. InChIKey: XUBMPLUQNSSFHO-UHFFFAOYSA-M.
| Molecular formula | C9H21NO3 |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | hydrogen carbonate;tetraethylazanium |
| InChIKey | XUBMPLUQNSSFHO-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC.C(=O)(O)[O-] |
Computed by PubChem (NCBI)