CAS 173558-71-9 appears in our catalog under these names: Methyl 2-diazo-3,3,3-trifluoro-propionate, Methyl 2-diazo-3,3,3-trifluoro-propionate, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 50mg, 0,5g, 1g.
Methyl 2-diazo-3,3,3-trifluoropropanoate (CAS 173558-71-9) is a chemical compound with the molecular formula C4H3F3N2O2 and a molecular weight of 168.07 g/mol. IUPAC name: methyl 2-diazo-3,3,3-trifluoropropanoate. InChIKey: CRPRBPSWJPEAMC-UHFFFAOYSA-N.
| Molecular formula | C4H3F3N2O2 |
|---|---|
| Molecular weight | 168.07 g/mol |
| IUPAC name | methyl 2-diazo-3,3,3-trifluoropropanoate |
| InChIKey | CRPRBPSWJPEAMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=[N+]=[N-])C(F)(F)F |
Computed by PubChem (NCBI)