CAS 17358-66-6 appears in our catalog under these names: 1-[(4-Methylphenyl)sulfonyl]azetidin-3-yl 4-methylbenzenesulfonate, 98%, 1-Tosylazetidin-3-yl 4-methylbenzenesulfonate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
[1-(4-methylphenyl)sulfonylazetidin-3-yl] 4-methylbenzenesulfonate (CAS 17358-66-6) is a chemical compound with the molecular formula C17H19NO5S2 and a molecular weight of 381.5 g/mol. IUPAC name: [1-(4-methylphenyl)sulfonylazetidin-3-yl] 4-methylbenzenesulfonate. InChIKey: WLACHXTYEAWUMM-UHFFFAOYSA-N.
| Molecular formula | C17H19NO5S2 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | [1-(4-methylphenyl)sulfonylazetidin-3-yl] 4-methylbenzenesulfonate |
| InChIKey | WLACHXTYEAWUMM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC(C2)OS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)