CAS 1736-70-5 appears in our catalog under these names: (3-(trifluoromethyl)phenyl)thiourea, 1-(3-(Trifluoromethyl)phenyl)thiourea 98%, 1-[3-(Trifluoromethyl)phenyl]-2-thiourea, 95%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
[3-(trifluoromethyl)phenyl]thiourea (CAS 1736-70-5) is a chemical compound with the molecular formula C8H7F3N2S and a molecular weight of 220.22 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl]thiourea. InChIKey: WKRUQAYFMKZMPJ-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2S |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl]thiourea |
| InChIKey | WKRUQAYFMKZMPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=S)N)C(F)(F)F |
Computed by PubChem (NCBI)