CAS 1736-87-4 appears in our catalog under these names: 2,3-Dimethyl-4-fluoronitrobenzene 98%, 2,3-Dimethyl-4-fluoronitrobenzene, >98.0%(GC), 3–Fluoro–1,2–dimethyl–6–nitrobenzene, 3-Fluoro-6-nitro-o-xylene, 98%. Offered by: Ambeed, TCI, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-fluoro-2,3-dimethyl-4-nitrobenzene (CAS 1736-87-4) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: 1-fluoro-2,3-dimethyl-4-nitrobenzene. InChIKey: GLDMIZKOJPVEIV-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | 1-fluoro-2,3-dimethyl-4-nitrobenzene |
| InChIKey | GLDMIZKOJPVEIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)