CAS 173604-87-0 appears in our catalog under these names: (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl carbonate, 96%, (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl 4-nitrophenyl carbonate, (5-Methyl-2-oxo-1,3-dioxol-4-YL)methyl 4-nitrophenyl carbonate, 97%, 97%, (5-METHYL-2-OXO-1,3-DIOXOL-4-YL)METHYL 4-NITROPHENYL CARBONATE, 97%, (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl (4-nitrophenyl) carbonate, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg, 5g, 10g.
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (4-nitrophenyl) carbonate (CAS 173604-87-0) is a chemical compound with the molecular formula C12H9NO8 and a molecular weight of 295.20 g/mol. IUPAC name: (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (4-nitrophenyl) carbonate. InChIKey: MZGIKNSLLFWGKL-UHFFFAOYSA-N.
| Molecular formula | C12H9NO8 |
|---|---|
| Molecular weight | 295.20 g/mol |
| IUPAC name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (4-nitrophenyl) carbonate |
| InChIKey | MZGIKNSLLFWGKL-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=O)O1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)