CAS 173606-50-3 appears in our catalog under these names: 10–((tert–Butoxycarbonyl)amino)decanoic acid, Boc-10-Adc-OH, Boc-10-Aminodecanoic acid 98%, 10-((tert-Butoxycarbonyl)amino)decanoic acid, 97%, 97%, Boc-10-Aminodecanoic acid, 97.0%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 25g, 5g, 100mg, 10g, 10 g, 5 g.
10-[(2-methylpropan-2-yl)oxycarbonylamino]decanoic acid (CAS 173606-50-3) is a chemical compound with the molecular formula C15H29NO4 and a molecular weight of 287.39 g/mol. IUPAC name: 10-[(2-methylpropan-2-yl)oxycarbonylamino]decanoic acid. InChIKey: DUNPXMOBBKBKHK-UHFFFAOYSA-N.
| Molecular formula | C15H29NO4 |
|---|---|
| Molecular weight | 287.39 g/mol |
| IUPAC name | 10-[(2-methylpropan-2-yl)oxycarbonylamino]decanoic acid |
| InChIKey | DUNPXMOBBKBKHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCCC(=O)O |
Computed by PubChem (NCBI)