CAS 173725-23-0 is the registry number for Nonyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 1mg.
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-nonoxyoxan-2-yl]methyl acetate (CAS 173725-23-0) is a chemical compound with the molecular formula C23H39NO9 and a molecular weight of 473.6 g/mol. IUPAC name: [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-nonoxyoxan-2-yl]methyl acetate. InChIKey: NNNCCZODQRUEHT-GNJRFXKQSA-N.
| Molecular formula | C23H39NO9 |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-nonoxyoxan-2-yl]methyl acetate |
| InChIKey | NNNCCZODQRUEHT-GNJRFXKQSA-N |
| SMILES | CCCCCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C |
Computed by PubChem (NCBI)