CAS 1738-82-5 appears in our catalog under these names: Benzyl 2-(2-aminoacetamido)acetate 4-methylbenzenesulfonate, 95%, H–Gly–Gly–OBzl · p–tosylate, H-Gly-Gly-OBzl·p-tosylate, Glycylglycine Benzyl Ester p-Toluenesulfonate, >98.0%(HPLC)(N)(T), H-Gly-Gly-OBzl.TosOH 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 5g, 100g, 25g, 500g, 100mg, 250mg.
Benzyl 2-[(2-aminoacetyl)amino]acetate;4-methylbenzenesulfonic acid (CAS 1738-82-5) is a chemical compound with the molecular formula C18H22N2O6S and a molecular weight of 394.4 g/mol. IUPAC name: benzyl 2-[(2-aminoacetyl)amino]acetate;4-methylbenzenesulfonic acid. InChIKey: RWBJLSORGVEMHA-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O6S |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | benzyl 2-[(2-aminoacetyl)amino]acetate;4-methylbenzenesulfonic acid |
| InChIKey | RWBJLSORGVEMHA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)CNC(=O)CN |
Computed by PubChem (NCBI)