CAS 173897-43-3 appears in our catalog under these names: 3-(Aminomethyl)-N-(pyridin-4-yl)benzamide dihydrochloride, 3-(Aminomethyl)-N-(pyridin-4-yl)benzamide dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g, 1g.
3-(aminomethyl)-N-pyridin-4-ylbenzamide;dihydrochloride (CAS 173897-43-3) is a chemical compound with the molecular formula C13H15Cl2N3O and a molecular weight of 300.18 g/mol. IUPAC name: 3-(aminomethyl)-N-pyridin-4-ylbenzamide;dihydrochloride. InChIKey: FKPBBIXDFXBKRL-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2N3O |
|---|---|
| Molecular weight | 300.18 g/mol |
| IUPAC name | 3-(aminomethyl)-N-pyridin-4-ylbenzamide;dihydrochloride |
| InChIKey | FKPBBIXDFXBKRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)NC2=CC=NC=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)