CAS 173999-08-1 appears in our catalog under these names: (5-([tert-Butyl(dimethyl)silyl]oxy)pyridin-3-yl)boronic acid, 95%, (5-{[(tert-Butyldimethylsilyl)oxy]methyl}pyridin-3-yl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]boronic acid (CAS 173999-08-1) is a chemical compound with the molecular formula C12H22BNO3Si and a molecular weight of 267.21 g/mol. IUPAC name: [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]boronic acid. InChIKey: FLRUIXQERZICDX-UHFFFAOYSA-N.
| Molecular formula | C12H22BNO3Si |
|---|---|
| Molecular weight | 267.21 g/mol |
| IUPAC name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]boronic acid |
| InChIKey | FLRUIXQERZICDX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)CO[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)