CAS 1740-25-6 is the registry number for 1H-Imidazole, 2-(2-bromophenyl)-4,5-diphenyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
2-(2-bromophenyl)-4,5-diphenyl-1H-imidazole (CAS 1740-25-6) is a chemical compound with the molecular formula C21H15BrN2 and a molecular weight of 375.3 g/mol. IUPAC name: 2-(2-bromophenyl)-4,5-diphenyl-1H-imidazole. InChIKey: KSSDKMKDIXQDPB-UHFFFAOYSA-N.
| Molecular formula | C21H15BrN2 |
|---|---|
| Molecular weight | 375.3 g/mol |
| IUPAC name | 2-(2-bromophenyl)-4,5-diphenyl-1H-imidazole |
| InChIKey | KSSDKMKDIXQDPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=CC=C3Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)