Products 1740-25-6

CAS 1740-25-6 is the registry number for 1H-Imidazole, 2-(2-bromophenyl)-4,5-diphenyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-(2-bromophenyl)-4,5-diphenyl-1H-imidazole (CAS 1740-25-6) is a chemical compound with the molecular formula C21H15BrN2 and a molecular weight of 375.3 g/mol. IUPAC name: 2-(2-bromophenyl)-4,5-diphenyl-1H-imidazole. InChIKey: KSSDKMKDIXQDPB-UHFFFAOYSA-N.

Identity
Molecular formulaC21H15BrN2
Molecular weight375.3 g/mol
IUPAC name2-(2-bromophenyl)-4,5-diphenyl-1H-imidazole
InChIKeyKSSDKMKDIXQDPB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=CC=C3Br)C4=CC=CC=C4

Computed by PubChem (NCBI)