CAS 174083-39-7 is the registry number for 3,5-Bis(trifluoromethyl)phenylacetyl chloride, 98%. Offered by: Combi-blocks. Available pack sizes: 100g, 5g, 25g.
2-[3,5-bis(trifluoromethyl)phenyl]acetyl chloride (CAS 174083-39-7) is a chemical compound with the molecular formula C10H5ClF6O and a molecular weight of 290.59 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]acetyl chloride. InChIKey: TVVPYLZQEFOTGP-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF6O |
|---|---|
| Molecular weight | 290.59 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]acetyl chloride |
| InChIKey | TVVPYLZQEFOTGP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CC(=O)Cl |
Computed by PubChem (NCBI)