CAS 1743-96-0 appears in our catalog under these names: 1-Nitro-4-(perfluoroethoxy)benzene, 95+%, 1-Nitro-4-(pentafluoroethoxy)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-nitro-4-(1,1,2,2,2-pentafluoroethoxy)benzene (CAS 1743-96-0) is a chemical compound with the molecular formula C8H4F5NO3 and a molecular weight of 257.11 g/mol. IUPAC name: 1-nitro-4-(1,1,2,2,2-pentafluoroethoxy)benzene. InChIKey: MKBFCCDCVFHRLX-UHFFFAOYSA-N.
| Molecular formula | C8H4F5NO3 |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 1-nitro-4-(1,1,2,2,2-pentafluoroethoxy)benzene |
| InChIKey | MKBFCCDCVFHRLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)