CAS 17432-66-5 is the registry number for 5-(phenylamino)penta-2,4-dienal. Offered by: Chemat Brand. Available pack sizes: on request.
(2E,4E)-5-anilinopenta-2,4-dienal (CAS 17432-66-5) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: (2E,4E)-5-anilinopenta-2,4-dienal. InChIKey: YKTQTUDDMWCFJI-VDESZNBCSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (2E,4E)-5-anilinopenta-2,4-dienal |
| InChIKey | YKTQTUDDMWCFJI-VDESZNBCSA-N |
| SMILES | C1=CC=C(C=C1)N/C=C/C=C/C=O |
Computed by PubChem (NCBI)