Products 174423-30-4
CAS 174423-30-4 appears in our catalog under these names: Sanggenol A, Sanggenol A, Sanggenol A, 99.83%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 5 mg, 10 mg, 1 mg.
(2S)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one (CAS 174423-30-4) is a chemical compound with the molecular formula C25H28O6 and a molecular weight of 424.5 g/mol. IUPAC name: (2S)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one. InChIKey: QNPMSYLDWCXEOI-CEMXSPGASA-N.
| Molecular formula | C25H28O6 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | (2S)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| InChIKey | QNPMSYLDWCXEOI-CEMXSPGASA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C=CC(=C1O)[C@@H]2CC(=O)C3=C(C=C(C=C3O2)O)O)O)/C)C |
Computed by PubChem (NCBI)