Products 174454-41-2

CAS 174454-41-2 is the registry number for 2-(2-Bromothiophen-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(2-bromothiophen-3-yl)acetic acid (CAS 174454-41-2) is a chemical compound with the molecular formula C6H5BrO2S and a molecular weight of 221.07 g/mol. IUPAC name: 2-(2-bromothiophen-3-yl)acetic acid. InChIKey: CGQRDVQJIXQIRB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrO2S
Molecular weight221.07 g/mol
IUPAC name2-(2-bromothiophen-3-yl)acetic acid
InChIKeyCGQRDVQJIXQIRB-UHFFFAOYSA-N
SMILESC1=CSC(=C1CC(=O)O)Br

Computed by PubChem (NCBI)