CAS 174466-48-9 is the registry number for Methyl (N-(tert-butoxycarbonyl)sulfamoyl)glycinate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 10g.
Methyl 2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]acetate (CAS 174466-48-9) is a chemical compound with the molecular formula C8H16N2O6S and a molecular weight of 268.29 g/mol. IUPAC name: methyl 2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]acetate. InChIKey: LUFZRUXWJBVEPQ-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O6S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]acetate |
| InChIKey | LUFZRUXWJBVEPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCC(=O)OC |
Computed by PubChem (NCBI)